C12H13ClN4O2S — CID 62144333
N-(3-chlorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide (PubChem CID 62144333) has the molecular formula C12H13ClN4O2S and a molecular weight of 312.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-(3-chlorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62144333 |
| Molecular Formula | C12H13ClN4O2S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-(3-chlorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)Nc2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C12H13ClN4O2S/c1-2-14-12-15-7-11(8-16-12)20(18,19)17-10-5-3-4-9(13)6-10/h3-8,17H,2H2,1H3,(H,14,15,16) |
| InChIKey | DHHLERUUCDHAFZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |