C12H12ClFN4O2S — CID 62144758
N-(3-chloro-4-fluorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide (PubChem CID 62144758) has the molecular formula C12H12ClFN4O2S and a molecular weight of 330.77 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62144758 |
| Molecular Formula | C12H12ClFN4O2S |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)Nc2ccc(F)c(Cl)c2)cn1 |
| InChI | InChI=1S/C12H12ClFN4O2S/c1-2-15-12-16-6-9(7-17-12)21(19,20)18-8-3-4-11(14)10(13)5-8/h3-7,18H,2H2,1H3,(H,15,16,17) |
| InChIKey | FOQOCCMMHQLCHC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |