C12H12BrClN4O2S — CID 103481345
N-(2-bromo-3-chlorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide (PubChem CID 103481345) has the molecular formula C12H12BrClN4O2S and a molecular weight of 391.68 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 103481345 |
| Molecular Formula | C12H12BrClN4O2S |
| Molecular Weight | 391.68 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-2-(ethylamino)pyrimidine-5-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)Nc2cccc(Cl)c2Br)cn1 |
| InChI | InChI=1S/C12H12BrClN4O2S/c1-2-15-12-16-6-8(7-17-12)21(19,20)18-10-5-3-4-9(14)11(10)13/h3-7,18H,2H2,1H3,(H,15,16,17) |
| InChIKey | ISQINXRNHNVRQF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.68 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |