C13H13Cl2N3O2S — CID 62149087
N-(2,3-dichlorophenyl)-6-(ethylamino)pyridine-3-sulfonamide (PubChem CID 62149087) has the molecular formula C13H13Cl2N3O2S and a molecular weight of 346.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-6-(ethylamino)pyridine-3-sulfonamide.
| Compound Name | N-(2,3-dichlorophenyl)-6-(ethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62149087 |
| Molecular Formula | C13H13Cl2N3O2S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-6-(ethylamino)pyridine-3-sulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)Nc2cccc(Cl)c2Cl)cn1 |
| InChI | InChI=1S/C13H13Cl2N3O2S/c1-2-16-12-7-6-9(8-17-12)21(19,20)18-11-5-3-4-10(14)13(11)15/h3-8,18H,2H2,1H3,(H,16,17) |
| InChIKey | KFJNSGISGJAWEV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |