C11H13N5O2S — CID 116787805
6-(ethylamino)-N-pyridazin-3-ylpyridine-3-sulfonamide (PubChem CID 116787805) has the molecular formula C11H13N5O2S and a molecular weight of 279.32 g/mol. Its IUPAC name is 6-(ethylamino)-N-pyridazin-3-ylpyridine-3-sulfonamide.
| Compound Name | 6-(ethylamino)-N-pyridazin-3-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 116787805 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 6-(ethylamino)-N-pyridazin-3-ylpyridine-3-sulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)Nc2cccnn2)cn1 |
| InChI | InChI=1S/C11H13N5O2S/c1-2-12-10-6-5-9(8-13-10)19(17,18)16-11-4-3-7-14-15-11/h3-8H,2H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | HQRCIIJQISRJKF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |