C10H12N6O2S — CID 114389293
6-(ethylamino)-N-(1,2,4-triazin-3-yl)pyridine-3-sulfonamide (PubChem CID 114389293) has the molecular formula C10H12N6O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is 6-(ethylamino)-N-(1,2,4-triazin-3-yl)pyridine-3-sulfonamide.
| Compound Name | 6-(ethylamino)-N-(1,2,4-triazin-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114389293 |
| Molecular Formula | C10H12N6O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 6-(ethylamino)-N-(1,2,4-triazin-3-yl)pyridine-3-sulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)Nc2nccnn2)cn1 |
| InChI | InChI=1S/C10H12N6O2S/c1-2-11-9-4-3-8(7-13-9)19(17,18)16-10-12-5-6-14-15-10/h3-7H,2H2,1H3,(H,11,13)(H,12,15,16) |
| InChIKey | CXHQVQFIISZJJY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |