C10H11BrN4O2S2 — CID 62147032
N-(5-bromo-1,3-thiazol-2-yl)-6-(ethylamino)pyridine-3-sulfonamide (PubChem CID 62147032) has the molecular formula C10H11BrN4O2S2 and a molecular weight of 363.26 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-6-(ethylamino)pyridine-3-sulfonamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-6-(ethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62147032 |
| Molecular Formula | C10H11BrN4O2S2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-6-(ethylamino)pyridine-3-sulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)Nc2ncc(Br)s2)cn1 |
| InChI | InChI=1S/C10H11BrN4O2S2/c1-2-12-9-4-3-7(5-13-9)19(16,17)15-10-14-6-8(11)18-10/h3-6H,2H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | KWALYIFDOJGMRP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |