C10H11N3O3S — CID 43535283
4-hydroxy-N-(1-methylpyrazol-4-yl)benzenesulfonamide (PubChem CID 43535283) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 4-hydroxy-N-(1-methylpyrazol-4-yl)benzenesulfonamide.
| Compound Name | 4-hydroxy-N-(1-methylpyrazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43535283 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 4-hydroxy-N-(1-methylpyrazol-4-yl)benzenesulfonamide |
| SMILES | Cn1cc(NS(=O)(=O)c2ccc(O)cc2)cn1 |
| InChI | InChI=1S/C10H11N3O3S/c1-13-7-8(6-11-13)12-17(15,16)10-4-2-9(14)3-5-10/h2-7,12,14H,1H3 |
| InChIKey | IQYNBYZJMOHJBV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |