C11H14N4O4S — CID 43644624
1-ethyl-4-[(1-methylpyrazol-4-yl)sulfamoyl]pyrrole-2-carboxylic acid (PubChem CID 43644624) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is 1-ethyl-4-[(1-methylpyrazol-4-yl)sulfamoyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-[(1-methylpyrazol-4-yl)sulfamoyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43644624 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-ethyl-4-[(1-methylpyrazol-4-yl)sulfamoyl]pyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)Nc2cnn(C)c2)cc1C(=O)O |
| InChI | InChI=1S/C11H14N4O4S/c1-3-15-7-9(4-10(15)11(16)17)20(18,19)13-8-5-12-14(2)6-8/h4-7,13H,3H2,1-2H3,(H,16,17) |
| InChIKey | IXOZJMPZWBGMAR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |