C14H22N2O4S — CID 60920573
4-(2-cyclopentylethylsulfamoyl)-1-ethylpyrrole-2-carboxylic acid (PubChem CID 60920573) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-(2-cyclopentylethylsulfamoyl)-1-ethylpyrrole-2-carboxylic acid.
| Compound Name | 4-(2-cyclopentylethylsulfamoyl)-1-ethylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 60920573 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-(2-cyclopentylethylsulfamoyl)-1-ethylpyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)NCCC2CCCC2)cc1C(=O)O |
| InChI | InChI=1S/C14H22N2O4S/c1-2-16-10-12(9-13(16)14(17)18)21(19,20)15-8-7-11-5-3-4-6-11/h9-11,15H,2-8H2,1H3,(H,17,18) |
| InChIKey | RGQIUSFFAOMZDK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |