C11H15F3N2O4S — CID 115515817
1-ethyl-4-(4,4,4-trifluorobutylsulfamoyl)pyrrole-2-carboxylic acid (PubChem CID 115515817) has the molecular formula C11H15F3N2O4S and a molecular weight of 328.31 g/mol. Its IUPAC name is 1-ethyl-4-(4,4,4-trifluorobutylsulfamoyl)pyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-(4,4,4-trifluorobutylsulfamoyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 115515817 |
| Molecular Formula | C11H15F3N2O4S |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-ethyl-4-(4,4,4-trifluorobutylsulfamoyl)pyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)NCCCC(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C11H15F3N2O4S/c1-2-16-7-8(6-9(16)10(17)18)21(19,20)15-5-3-4-11(12,13)14/h6-7,15H,2-5H2,1H3,(H,17,18) |
| InChIKey | SRXHZDGXPNVXAJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|