C9H13N3O5S — CID 43644264
4-[(2-amino-2-oxoethyl)sulfamoyl]-1-ethylpyrrole-2-carboxylic acid (PubChem CID 43644264) has the molecular formula C9H13N3O5S and a molecular weight of 275.29 g/mol. Its IUPAC name is 4-[(2-amino-2-oxoethyl)sulfamoyl]-1-ethylpyrrole-2-carboxylic acid.
| Compound Name | 4-[(2-amino-2-oxoethyl)sulfamoyl]-1-ethylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43644264 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4-[(2-amino-2-oxoethyl)sulfamoyl]-1-ethylpyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)NCC(N)=O)cc1C(=O)O |
| InChI | InChI=1S/C9H13N3O5S/c1-2-12-5-6(3-7(12)9(14)15)18(16,17)11-4-8(10)13/h3,5,11H,2,4H2,1H3,(H2,10,13)(H,14,15) |
| InChIKey | VTYYPMYEKUKLBL-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |