C12H20N2O5S — CID 66091074
1-ethyl-4-[(4-hydroxy-2-methylbutyl)sulfamoyl]pyrrole-2-carboxylic acid (PubChem CID 66091074) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 1-ethyl-4-[(4-hydroxy-2-methylbutyl)sulfamoyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-[(4-hydroxy-2-methylbutyl)sulfamoyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 66091074 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-ethyl-4-[(4-hydroxy-2-methylbutyl)sulfamoyl]pyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)NCC(C)CCO)cc1C(=O)O |
| InChI | InChI=1S/C12H20N2O5S/c1-3-14-8-10(6-11(14)12(16)17)20(18,19)13-7-9(2)4-5-15/h6,8-9,13,15H,3-5,7H2,1-2H3,(H,16,17) |
| InChIKey | OZXZLXHXQYSWBU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |