C11H18N2O6S — CID 66169532
4-(2,3-dihydroxypropylsulfamoyl)-1-propylpyrrole-2-carboxylic acid (PubChem CID 66169532) has the molecular formula C11H18N2O6S and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylsulfamoyl)-1-propylpyrrole-2-carboxylic acid.
| Compound Name | 4-(2,3-dihydroxypropylsulfamoyl)-1-propylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 66169532 |
| Molecular Formula | C11H18N2O6S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-(2,3-dihydroxypropylsulfamoyl)-1-propylpyrrole-2-carboxylic acid |
| SMILES | CCCn1cc(S(=O)(=O)NCC(O)CO)cc1C(=O)O |
| InChI | InChI=1S/C11H18N2O6S/c1-2-3-13-6-9(4-10(13)11(16)17)20(18,19)12-5-8(15)7-14/h4,6,8,12,14-15H,2-3,5,7H2,1H3,(H,16,17) |
| InChIKey | CYCKSDNCSUQIGJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |