C14H24N2O4S — CID 64571046
4-(2,3-dimethylbutylsulfamoyl)-1-propylpyrrole-2-carboxylic acid (PubChem CID 64571046) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-(2,3-dimethylbutylsulfamoyl)-1-propylpyrrole-2-carboxylic acid.
| Compound Name | 4-(2,3-dimethylbutylsulfamoyl)-1-propylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 64571046 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-(2,3-dimethylbutylsulfamoyl)-1-propylpyrrole-2-carboxylic acid |
| SMILES | CCCn1cc(S(=O)(=O)NCC(C)C(C)C)cc1C(=O)O |
| InChI | InChI=1S/C14H24N2O4S/c1-5-6-16-9-12(7-13(16)14(17)18)21(19,20)15-8-11(4)10(2)3/h7,9-11,15H,5-6,8H2,1-4H3,(H,17,18) |
| InChIKey | PDMJJLHJJNHHME-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |