C13H20N2O4S2 — CID 106426813
4-(2-prop-2-enylsulfanylethylsulfamoyl)-1-propylpyrrole-2-carboxylic acid (PubChem CID 106426813) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-(2-prop-2-enylsulfanylethylsulfamoyl)-1-propylpyrrole-2-carboxylic acid.
| Compound Name | 4-(2-prop-2-enylsulfanylethylsulfamoyl)-1-propylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 106426813 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 4-(2-prop-2-enylsulfanylethylsulfamoyl)-1-propylpyrrole-2-carboxylic acid |
| SMILES | C=CCSCCNS(=O)(=O)c1cc(C(=O)O)n(CCC)c1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-3-6-15-10-11(9-12(15)13(16)17)21(18,19)14-5-8-20-7-4-2/h4,9-10,14H,2-3,5-8H2,1H3,(H,16,17) |
| InChIKey | OCJXXACMCPBTNN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|