C10H16N2O4S2 — CID 43644613
1-ethyl-4-(2-methylsulfanylethylsulfamoyl)pyrrole-2-carboxylic acid (PubChem CID 43644613) has the molecular formula C10H16N2O4S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-ethyl-4-(2-methylsulfanylethylsulfamoyl)pyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-(2-methylsulfanylethylsulfamoyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43644613 |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-ethyl-4-(2-methylsulfanylethylsulfamoyl)pyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)NCCSC)cc1C(=O)O |
| InChI | InChI=1S/C10H16N2O4S2/c1-3-12-7-8(6-9(12)10(13)14)18(15,16)11-4-5-17-2/h6-7,11H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | LIOONAJFKNTCQV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|