C11H18N2O4S2 — CID 43644614
4-(2-methylsulfanylethylsulfamoyl)-1-propan-2-ylpyrrole-2-carboxylic acid (PubChem CID 43644614) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-(2-methylsulfanylethylsulfamoyl)-1-propan-2-ylpyrrole-2-carboxylic acid.
| Compound Name | 4-(2-methylsulfanylethylsulfamoyl)-1-propan-2-ylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43644614 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-(2-methylsulfanylethylsulfamoyl)-1-propan-2-ylpyrrole-2-carboxylic acid |
| SMILES | CSCCNS(=O)(=O)c1cc(C(=O)O)n(C(C)C)c1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-8(2)13-7-9(6-10(13)11(14)15)19(16,17)12-4-5-18-3/h6-8,12H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | LZIRRSAJSGPQNV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|