C12H20N2O5S — CID 62332568
4-[2-hydroxypropyl(methyl)sulfamoyl]-1-propan-2-ylpyrrole-2-carboxylic acid (PubChem CID 62332568) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-[2-hydroxypropyl(methyl)sulfamoyl]-1-propan-2-ylpyrrole-2-carboxylic acid.
| Compound Name | 4-[2-hydroxypropyl(methyl)sulfamoyl]-1-propan-2-ylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 62332568 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-[2-hydroxypropyl(methyl)sulfamoyl]-1-propan-2-ylpyrrole-2-carboxylic acid |
| SMILES | CC(O)CN(C)S(=O)(=O)c1cc(C(=O)O)n(C(C)C)c1 |
| InChI | InChI=1S/C12H20N2O5S/c1-8(2)14-7-10(5-11(14)12(16)17)20(18,19)13(4)6-9(3)15/h5,7-9,15H,6H2,1-4H3,(H,16,17) |
| InChIKey | VONWLKJTRYZWBB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |