C14H24N2O4S — CID 61044010
4-(4-methylpentylsulfamoyl)-1-propan-2-ylpyrrole-2-carboxylic acid (PubChem CID 61044010) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-(4-methylpentylsulfamoyl)-1-propan-2-ylpyrrole-2-carboxylic acid.
| Compound Name | 4-(4-methylpentylsulfamoyl)-1-propan-2-ylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 61044010 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-(4-methylpentylsulfamoyl)-1-propan-2-ylpyrrole-2-carboxylic acid |
| SMILES | CC(C)CCCNS(=O)(=O)c1cc(C(=O)O)n(C(C)C)c1 |
| InChI | InChI=1S/C14H24N2O4S/c1-10(2)6-5-7-15-21(19,20)12-8-13(14(17)18)16(9-12)11(3)4/h8-11,15H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | NZLKYYVDTQBZFC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|