C12H18N2O4S — CID 43644167
1-propan-2-yl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylic acid (PubChem CID 43644167) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-propan-2-yl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylic acid.
| Compound Name | 1-propan-2-yl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43644167 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-propan-2-yl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylic acid |
| SMILES | CC(C)n1cc(S(=O)(=O)N2CCCC2)cc1C(=O)O |
| InChI | InChI=1S/C12H18N2O4S/c1-9(2)14-8-10(7-11(14)12(15)16)19(17,18)13-5-3-4-6-13/h7-9H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | BRNNAXAWNWSMKV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |