C10H12ClNO4S2 — CID 43396102
2-chloro-5-(2-methylsulfanylethylsulfamoyl)benzoic acid (PubChem CID 43396102) has the molecular formula C10H12ClNO4S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 2-chloro-5-(2-methylsulfanylethylsulfamoyl)benzoic acid.
| Compound Name | 2-chloro-5-(2-methylsulfanylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 43396102 |
| Molecular Formula | C10H12ClNO4S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 2-chloro-5-(2-methylsulfanylethylsulfamoyl)benzoic acid |
| SMILES | CSCCNS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H12ClNO4S2/c1-17-5-4-12-18(15,16)7-2-3-9(11)8(6-7)10(13)14/h2-3,6,12H,4-5H2,1H3,(H,13,14) |
| InChIKey | TVZWHTADWWISRK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|