C11H15NO5S2 — CID 43525950
2-methoxy-5-(2-methylsulfanylethylsulfamoyl)benzoic acid (PubChem CID 43525950) has the molecular formula C11H15NO5S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-methoxy-5-(2-methylsulfanylethylsulfamoyl)benzoic acid.
| Compound Name | 2-methoxy-5-(2-methylsulfanylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 43525950 |
| Molecular Formula | C11H15NO5S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 2-methoxy-5-(2-methylsulfanylethylsulfamoyl)benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)NCCSC)cc1C(=O)O |
| InChI | InChI=1S/C11H15NO5S2/c1-17-10-4-3-8(7-9(10)11(13)14)19(15,16)12-5-6-18-2/h3-4,7,12H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | ZCZARJXGJVAHGA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|