C13H17NO7S2 — CID 102552943
5-[(1-carboxy-3-methylsulfanylpropyl)sulfamoyl]-2-methoxybenzoic acid (PubChem CID 102552943) has the molecular formula C13H17NO7S2 and a molecular weight of 363.41 g/mol. Its IUPAC name is 5-[(1-carboxy-3-methylsulfanylpropyl)sulfamoyl]-2-methoxybenzoic acid.
| Compound Name | 5-[(1-carboxy-3-methylsulfanylpropyl)sulfamoyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 102552943 |
| Molecular Formula | C13H17NO7S2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 5-[(1-carboxy-3-methylsulfanylpropyl)sulfamoyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)NC(CCSC)C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C13H17NO7S2/c1-21-11-4-3-8(7-9(11)12(15)16)23(19,20)14-10(13(17)18)5-6-22-2/h3-4,7,10,14H,5-6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | BBXVFOIOIFPCBO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |