C13H17NO7S — CID 97032269
5-[[(1R)-1-carboxy-2-methylpropyl]sulfamoyl]-2-methoxybenzoic acid (PubChem CID 97032269) has the molecular formula C13H17NO7S and a molecular weight of 331.35 g/mol. Its IUPAC name is 5-[[(1R)-1-carboxy-2-methylpropyl]sulfamoyl]-2-methoxybenzoic acid.
| Compound Name | 5-[[(1R)-1-carboxy-2-methylpropyl]sulfamoyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 97032269 |
| Molecular Formula | C13H17NO7S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 5-[[(1R)-1-carboxy-2-methylpropyl]sulfamoyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C(=O)O)C(C)C)cc1C(=O)O |
| InChI | InChI=1S/C13H17NO7S/c1-7(2)11(13(17)18)14-22(19,20)8-4-5-10(21-3)9(6-8)12(15)16/h4-7,11,14H,1-3H3,(H,15,16)(H,17,18)/t11-/m1/s1 |
| InChIKey | FUZCMSKDJFHRCT-LLVKDONJSA-N |
| XLogP | 0.78 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |