C14H19NO7S — CID 120605776
(2R)-2-[(2-methoxy-4-methoxycarbonylphenyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 120605776) has the molecular formula C14H19NO7S and a molecular weight of 345.37 g/mol. Its IUPAC name is (2R)-2-[(2-methoxy-4-methoxycarbonylphenyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(2-methoxy-4-methoxycarbonylphenyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 120605776 |
| Molecular Formula | C14H19NO7S |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (2R)-2-[(2-methoxy-4-methoxycarbonylphenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N[C@@H](C(=O)O)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H19NO7S/c1-8(2)12(13(16)17)15-23(19,20)11-6-5-9(14(18)22-4)7-10(11)21-3/h5-8,12,15H,1-4H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | QRFJJUQTELQSJU-GFCCVEGCSA-N |
| XLogP | 0.87 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |