C15H21NO7S — CID 120605778
(2R)-2-[(2-methoxy-4-methoxycarbonylphenyl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 120605778) has the molecular formula C15H21NO7S and a molecular weight of 359.40 g/mol. Its IUPAC name is (2R)-2-[(2-methoxy-4-methoxycarbonylphenyl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(2-methoxy-4-methoxycarbonylphenyl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120605778 |
| Molecular Formula | C15H21NO7S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (2R)-2-[(2-methoxy-4-methoxycarbonylphenyl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N[C@H](CC(C)C)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C15H21NO7S/c1-9(2)7-11(14(17)18)16-24(20,21)13-6-5-10(15(19)23-4)8-12(13)22-3/h5-6,8-9,11,16H,7H2,1-4H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | YGDHSRBTQMMQNJ-LLVKDONJSA-N |
| XLogP | 1.26 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |