C13H21ClN2O5S — CID 120711512
methyl 4-[(2-amino-2-methylpropyl)sulfamoyl]-3-methoxybenzoate;hydrochloride (PubChem CID 120711512) has the molecular formula C13H21ClN2O5S and a molecular weight of 352.84 g/mol. Its IUPAC name is methyl 4-[(2-amino-2-methylpropyl)sulfamoyl]-3-methoxybenzoate;hydrochloride.
| Compound Name | methyl 4-[(2-amino-2-methylpropyl)sulfamoyl]-3-methoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 120711512 |
| Molecular Formula | C13H21ClN2O5S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | methyl 4-[(2-amino-2-methylpropyl)sulfamoyl]-3-methoxybenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC(C)(C)N)c(OC)c1.Cl |
| InChI | InChI=1S/C13H20N2O5S.ClH/c1-13(2,14)8-15-21(17,18)11-6-5-9(12(16)20-4)7-10(11)19-3;/h5-7,15H,8,14H2,1-4H3;1H |
| InChIKey | QJQORTJULVUVQV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |