C15H25Cl2N3O5S — CID 120707473
methyl 3-methoxy-4-(2-piperazin-1-ylethylsulfamoyl)benzoate;dihydrochloride (PubChem CID 120707473) has the molecular formula C15H25Cl2N3O5S and a molecular weight of 430.35 g/mol. Its IUPAC name is methyl 3-methoxy-4-(2-piperazin-1-ylethylsulfamoyl)benzoate;dihydrochloride.
| Compound Name | methyl 3-methoxy-4-(2-piperazin-1-ylethylsulfamoyl)benzoate;dihydrochloride |
|---|---|
| PubChem CID | 120707473 |
| Molecular Formula | C15H25Cl2N3O5S |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | methyl 3-methoxy-4-(2-piperazin-1-ylethylsulfamoyl)benzoate;dihydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCCN2CCNCC2)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C15H23N3O5S.2ClH/c1-22-13-11-12(15(19)23-2)3-4-14(13)24(20,21)17-7-10-18-8-5-16-6-9-18;;/h3-4,11,16-17H,5-10H2,1-2H3;2*1H |
| InChIKey | RTDXSSMEAZEZJN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |