C13H22BrCl2N3O2S — CID 120707438
4-bromo-2-methyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride (PubChem CID 120707438) has the molecular formula C13H22BrCl2N3O2S and a molecular weight of 435.22 g/mol. Its IUPAC name is 4-bromo-2-methyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride.
| Compound Name | 4-bromo-2-methyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 120707438 |
| Molecular Formula | C13H22BrCl2N3O2S |
| Molecular Weight | 435.22 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | 4-bromo-2-methyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride |
| SMILES | Cc1cc(Br)ccc1S(=O)(=O)NCCN1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H20BrN3O2S.2ClH/c1-11-10-12(14)2-3-13(11)20(18,19)16-6-9-17-7-4-15-5-8-17;;/h2-3,10,15-16H,4-9H2,1H3;2*1H |
| InChIKey | FUANIYLOQXDPNF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |