C13H19BrFN3O2S — CID 116527840
4-bromo-2-fluoro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide (PubChem CID 116527840) has the molecular formula C13H19BrFN3O2S and a molecular weight of 380.28 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 116527840 |
| Molecular Formula | C13H19BrFN3O2S |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 4-bromo-2-fluoro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCN1CCNCC1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H19BrFN3O2S/c14-11-2-3-13(12(15)10-11)21(19,20)17-4-1-7-18-8-5-16-6-9-18/h2-3,10,16-17H,1,4-9H2 |
| InChIKey | YPRAQPMXDPWBMM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|