C14H24BrCl2N3O2S — CID 120706365
4-bromo-2-methyl-N-(3-piperazin-1-ylpropyl)benzenesulfonamide;dihydrochloride (PubChem CID 120706365) has the molecular formula C14H24BrCl2N3O2S and a molecular weight of 449.24 g/mol. Its IUPAC name is 4-bromo-2-methyl-N-(3-piperazin-1-ylpropyl)benzenesulfonamide;dihydrochloride.
| Compound Name | 4-bromo-2-methyl-N-(3-piperazin-1-ylpropyl)benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 120706365 |
| Molecular Formula | C14H24BrCl2N3O2S |
| Molecular Weight | 449.24 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | 4-bromo-2-methyl-N-(3-piperazin-1-ylpropyl)benzenesulfonamide;dihydrochloride |
| SMILES | Cc1cc(Br)ccc1S(=O)(=O)NCCCN1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H22BrN3O2S.2ClH/c1-12-11-13(15)3-4-14(12)21(19,20)17-5-2-8-18-9-6-16-7-10-18;;/h3-4,11,16-17H,2,5-10H2,1H3;2*1H |
| InChIKey | JUPBZEYVMUZIKL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|