C13H22Cl2N4O4S — CID 119966622
2-methyl-4-nitro-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride (PubChem CID 119966622) has the molecular formula C13H22Cl2N4O4S and a molecular weight of 401.32 g/mol. Its IUPAC name is 2-methyl-4-nitro-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride.
| Compound Name | 2-methyl-4-nitro-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 119966622 |
| Molecular Formula | C13H22Cl2N4O4S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-methyl-4-nitro-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)NCCN1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H20N4O4S.2ClH/c1-11-10-12(17(18)19)2-3-13(11)22(20,21)15-6-9-16-7-4-14-5-8-16;;/h2-3,10,14-15H,4-9H2,1H3;2*1H |
| InChIKey | OTSWVPULBSJVHD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|