C13H19ClN4O4S — CID 119994665
2-chloro-4-nitro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide (PubChem CID 119994665) has the molecular formula C13H19ClN4O4S and a molecular weight of 362.84 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 2-chloro-4-nitro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119994665 |
| Molecular Formula | C13H19ClN4O4S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-chloro-4-nitro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NCCCN2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClN4O4S/c14-12-10-11(18(19)20)2-3-13(12)23(21,22)16-4-1-7-17-8-5-15-6-9-17/h2-3,10,15-16H,1,4-9H2 |
| InChIKey | GYPRBBZIJIJKPC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|