C12H19Cl3FN3O2S — CID 119966552
2-chloro-4-fluoro-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride (PubChem CID 119966552) has the molecular formula C12H19Cl3FN3O2S and a molecular weight of 394.73 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride.
| Compound Name | 2-chloro-4-fluoro-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 119966552 |
| Molecular Formula | C12H19Cl3FN3O2S |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-chloro-4-fluoro-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(NCCN1CCNCC1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H17ClFN3O2S.2ClH/c13-11-9-10(14)1-2-12(11)20(18,19)16-5-8-17-6-3-15-4-7-17;;/h1-2,9,15-16H,3-8H2;2*1H |
| InChIKey | LDIQHDXAYOJVTJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |