C14H12Cl2F2N2O4S2 — CID 52565640
2-chloro-N-[2-[(2-chloro-4-fluorophenyl)sulfonylamino]ethyl]-4-fluorobenzenesulfonamide (PubChem CID 52565640) has the molecular formula C14H12Cl2F2N2O4S2 and a molecular weight of 445.30 g/mol. Its IUPAC name is 2-chloro-N-[2-[(2-chloro-4-fluorophenyl)sulfonylamino]ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-chloro-N-[2-[(2-chloro-4-fluorophenyl)sulfonylamino]ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 52565640 |
| Molecular Formula | C14H12Cl2F2N2O4S2 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | 2-chloro-N-[2-[(2-chloro-4-fluorophenyl)sulfonylamino]ethyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCNS(=O)(=O)c1ccc(F)cc1Cl)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H12Cl2F2N2O4S2/c15-11-7-9(17)1-3-13(11)25(21,22)19-5-6-20-26(23,24)14-4-2-10(18)8-12(14)16/h1-4,7-8,19-20H,5-6H2 |
| InChIKey | IXPVACKGJBSFAA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|