C8H9ClFNO2S — CID 18338331
2-chloro-N-ethyl-4-fluorobenzenesulfonamide (PubChem CID 18338331) has the molecular formula C8H9ClFNO2S and a molecular weight of 237.68 g/mol. Its IUPAC name is 2-chloro-N-ethyl-4-fluorobenzenesulfonamide.
| Compound Name | 2-chloro-N-ethyl-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 18338331 |
| Molecular Formula | C8H9ClFNO2S |
| Molecular Weight | 237.68 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 2-chloro-N-ethyl-4-fluorobenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C8H9ClFNO2S/c1-2-11-14(12,13)8-4-3-6(10)5-7(8)9/h3-5,11H,2H2,1H3 |
| InChIKey | WCPDLDNKOVBPMC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |