C11H16ClFN2O4S2 — CID 49459653
2-chloro-N-[3-(ethylsulfonylamino)propyl]-4-fluorobenzenesulfonamide (PubChem CID 49459653) has the molecular formula C11H16ClFN2O4S2 and a molecular weight of 358.84 g/mol. Its IUPAC name is 2-chloro-N-[3-(ethylsulfonylamino)propyl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-chloro-N-[3-(ethylsulfonylamino)propyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 49459653 |
| Molecular Formula | C11H16ClFN2O4S2 |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 2-chloro-N-[3-(ethylsulfonylamino)propyl]-4-fluorobenzenesulfonamide |
| SMILES | CCS(=O)(=O)NCCCNS(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H16ClFN2O4S2/c1-2-20(16,17)14-6-3-7-15-21(18,19)11-5-4-9(13)8-10(11)12/h4-5,8,14-15H,2-3,6-7H2,1H3 |
| InChIKey | XHUUYGBWJWXHDF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|