C9H11ClFNO3S — CID 47154916
2-chloro-4-fluoro-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 47154916) has the molecular formula C9H11ClFNO3S and a molecular weight of 267.71 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 2-chloro-4-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47154916 |
| Molecular Formula | C9H11ClFNO3S |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 2-chloro-4-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C9H11ClFNO3S/c1-15-5-4-12-16(13,14)9-3-2-7(11)6-8(9)10/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | VJIAJHSWUOJZJJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|