C12H18ClFN2O3S — CID 103838118
2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-fluorobenzenesulfonamide (PubChem CID 103838118) has the molecular formula C12H18ClFN2O3S and a molecular weight of 324.81 g/mol. Its IUPAC name is 2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103838118 |
| Molecular Formula | C12H18ClFN2O3S |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-fluorobenzenesulfonamide |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H18ClFN2O3S/c1-12(17,8-16(2)3)7-15-20(18,19)11-5-4-9(14)6-10(11)13/h4-6,15,17H,7-8H2,1-3H3 |
| InChIKey | PWDCEDMLBHLFOD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |