C14H22ClFN2O — CID 103904335
1-[1-(2-chloro-4-fluorophenyl)ethylamino]-3-(dimethylamino)-2-methylpropan-2-ol (PubChem CID 103904335) has the molecular formula C14H22ClFN2O and a molecular weight of 288.79 g/mol. Its IUPAC name is 1-[1-(2-chloro-4-fluorophenyl)ethylamino]-3-(dimethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-[1-(2-chloro-4-fluorophenyl)ethylamino]-3-(dimethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 103904335 |
| Molecular Formula | C14H22ClFN2O |
| Molecular Weight | 288.79 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-[1-(2-chloro-4-fluorophenyl)ethylamino]-3-(dimethylamino)-2-methylpropan-2-ol |
| SMILES | CC(NCC(C)(O)CN(C)C)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H22ClFN2O/c1-10(12-6-5-11(16)7-13(12)15)17-8-14(2,19)9-18(3)4/h5-7,10,17,19H,8-9H2,1-4H3 |
| InChIKey | UQKHKXSFNLBMFD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.79 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |