C12H19F2N3O3S — CID 106140232
4-amino-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2,6-difluorobenzenesulfonamide (PubChem CID 106140232) has the molecular formula C12H19F2N3O3S and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-amino-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-amino-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106140232 |
| Molecular Formula | C12H19F2N3O3S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-amino-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2,6-difluorobenzenesulfonamide |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C12H19F2N3O3S/c1-12(18,7-17(2)3)6-16-21(19,20)11-9(13)4-8(15)5-10(11)14/h4-5,16,18H,6-7,15H2,1-3H3 |
| InChIKey | JJUMPZUKRDGPEK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|