C10H14F2N2O3S — CID 54889018
4-amino-2,6-difluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzenesulfonamide (PubChem CID 54889018) has the molecular formula C10H14F2N2O3S and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-amino-2,6-difluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-difluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 54889018 |
| Molecular Formula | C10H14F2N2O3S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-amino-2,6-difluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzenesulfonamide |
| SMILES | CC(C)(CO)NS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C10H14F2N2O3S/c1-10(2,5-15)14-18(16,17)9-7(11)3-6(13)4-8(9)12/h3-4,14-15H,5,13H2,1-2H3 |
| InChIKey | BTNSECAILSFUFS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|