C10H14ClFN2O3S — CID 103050568
3-amino-5-chloro-2-fluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzenesulfonamide (PubChem CID 103050568) has the molecular formula C10H14ClFN2O3S and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-amino-5-chloro-2-fluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-2-fluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103050568 |
| Molecular Formula | C10H14ClFN2O3S |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-amino-5-chloro-2-fluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzenesulfonamide |
| SMILES | CC(C)(CO)NS(=O)(=O)c1cc(Cl)cc(N)c1F |
| InChI | InChI=1S/C10H14ClFN2O3S/c1-10(2,5-15)14-18(16,17)8-4-6(11)3-7(13)9(8)12/h3-4,14-15H,5,13H2,1-2H3 |
| InChIKey | JROBWHJJTZXAMA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|