C11H15ClFN3O3S — CID 103052007
3-[(3-amino-5-chloro-2-fluorophenyl)sulfonylamino]-N-ethylpropanamide (PubChem CID 103052007) has the molecular formula C11H15ClFN3O3S and a molecular weight of 323.78 g/mol. Its IUPAC name is 3-[(3-amino-5-chloro-2-fluorophenyl)sulfonylamino]-N-ethylpropanamide.
| Compound Name | 3-[(3-amino-5-chloro-2-fluorophenyl)sulfonylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 103052007 |
| Molecular Formula | C11H15ClFN3O3S |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-[(3-amino-5-chloro-2-fluorophenyl)sulfonylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCNS(=O)(=O)c1cc(Cl)cc(N)c1F |
| InChI | InChI=1S/C11H15ClFN3O3S/c1-2-15-10(17)3-4-16-20(18,19)9-6-7(12)5-8(14)11(9)13/h5-6,16H,2-4,14H2,1H3,(H,15,17) |
| InChIKey | XULQNOPGQUHAHV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|