C11H13Cl2FN2O — CID 107574011
3-(3,5-dichloro-4-fluoroanilino)-N-ethylpropanamide (PubChem CID 107574011) has the molecular formula C11H13Cl2FN2O and a molecular weight of 279.14 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-fluoroanilino)-N-ethylpropanamide.
| Compound Name | 3-(3,5-dichloro-4-fluoroanilino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 107574011 |
| Molecular Formula | C11H13Cl2FN2O |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 3-(3,5-dichloro-4-fluoroanilino)-N-ethylpropanamide |
| SMILES | CCNC(=O)CCNc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2FN2O/c1-2-15-10(17)3-4-16-7-5-8(12)11(14)9(13)6-7/h5-6,16H,2-4H2,1H3,(H,15,17) |
| InChIKey | YRXCTHUSGDCGNE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|