C12H14Cl2FNO3 — CID 107575606
ethyl 2-[2-(3,5-dichloro-4-fluoroanilino)ethoxy]acetate (PubChem CID 107575606) has the molecular formula C12H14Cl2FNO3 and a molecular weight of 310.15 g/mol. Its IUPAC name is ethyl 2-[2-(3,5-dichloro-4-fluoroanilino)ethoxy]acetate.
| Compound Name | ethyl 2-[2-(3,5-dichloro-4-fluoroanilino)ethoxy]acetate |
|---|---|
| PubChem CID | 107575606 |
| Molecular Formula | C12H14Cl2FNO3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | ethyl 2-[2-(3,5-dichloro-4-fluoroanilino)ethoxy]acetate |
| SMILES | CCOC(=O)COCCNc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2FNO3/c1-2-19-11(17)7-18-4-3-16-8-5-9(13)12(15)10(14)6-8/h5-6,16H,2-4,7H2,1H3 |
| InChIKey | OSXUCUDEQBEVEC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|