C14H20ClNO5 — CID 103233182
ethyl 2-[2-(5-chloro-2,4-dimethoxyanilino)ethoxy]acetate (PubChem CID 103233182) has the molecular formula C14H20ClNO5 and a molecular weight of 317.77 g/mol. Its IUPAC name is ethyl 2-[2-(5-chloro-2,4-dimethoxyanilino)ethoxy]acetate.
| Compound Name | ethyl 2-[2-(5-chloro-2,4-dimethoxyanilino)ethoxy]acetate |
|---|---|
| PubChem CID | 103233182 |
| Molecular Formula | C14H20ClNO5 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | ethyl 2-[2-(5-chloro-2,4-dimethoxyanilino)ethoxy]acetate |
| SMILES | CCOC(=O)COCCNc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C14H20ClNO5/c1-4-21-14(17)9-20-6-5-16-11-7-10(15)12(18-2)8-13(11)19-3/h7-8,16H,4-6,9H2,1-3H3 |
| InChIKey | OZKWNGULGKMNEZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|