C10H13ClN2O3 — CID 28576076
2-(5-chloro-2,4-dimethoxyanilino)acetamide (PubChem CID 28576076) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethoxyanilino)acetamide.
| Compound Name | 2-(5-chloro-2,4-dimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 28576076 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-(5-chloro-2,4-dimethoxyanilino)acetamide |
| SMILES | COc1cc(OC)c(NCC(N)=O)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O3/c1-15-8-4-9(16-2)7(3-6(8)11)13-5-10(12)14/h3-4,13H,5H2,1-2H3,(H2,12,14) |
| InChIKey | UCHGBRFLVXFXNH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|