C11H16ClN3O3 — CID 77025331
3-(5-chloro-2,4-dimethoxyanilino)-N'-hydroxypropanimidamide (PubChem CID 77025331) has the molecular formula C11H16ClN3O3 and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-(5-chloro-2,4-dimethoxyanilino)-N'-hydroxypropanimidamide.
| Compound Name | 3-(5-chloro-2,4-dimethoxyanilino)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77025331 |
| Molecular Formula | C11H16ClN3O3 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-(5-chloro-2,4-dimethoxyanilino)-N'-hydroxypropanimidamide |
| SMILES | COc1cc(OC)c(NCCC(N)=NO)cc1Cl |
| InChI | InChI=1S/C11H16ClN3O3/c1-17-9-6-10(18-2)8(5-7(9)12)14-4-3-11(13)15-16/h5-6,14,16H,3-4H2,1-2H3,(H2,13,15) |
| InChIKey | GBYXQHWGZZFSEY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|